CAS 1170416-53-1 is the registry number for 4-(Ethoxycarbonyl)phthalic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-ethoxycarbonylphthalic acid (CAS 1170416-53-1) is a chemical compound with the molecular formula C11H10O6 and a molecular weight of 238.19 g/mol. IUPAC name: 4-ethoxycarbonylphthalic acid. InChIKey: GRCDWYLUYHRELN-UHFFFAOYSA-N.
| Molecular formula | C11H10O6 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 4-ethoxycarbonylphthalic acid |
| InChIKey | GRCDWYLUYHRELN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)