Products 1170416-53-1

CAS 1170416-53-1 is the registry number for 4-(Ethoxycarbonyl)phthalic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-ethoxycarbonylphthalic acid (CAS 1170416-53-1) is a chemical compound with the molecular formula C11H10O6 and a molecular weight of 238.19 g/mol. IUPAC name: 4-ethoxycarbonylphthalic acid. InChIKey: GRCDWYLUYHRELN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10O6
Molecular weight238.19 g/mol
IUPAC name4-ethoxycarbonylphthalic acid
InChIKeyGRCDWYLUYHRELN-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=C(C=C1)C(=O)O)C(=O)O

Computed by PubChem (NCBI)