Products 2112666-95-0
CAS 2112666-95-0 is the registry number for 7-(Ethoxycarbonyl)benzo[d][1,3]dioxole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-ethoxycarbonyl-1,3-benzodioxole-4-carboxylic acid (CAS 2112666-95-0) is a chemical compound with the molecular formula C11H10O6 and a molecular weight of 238.19 g/mol. IUPAC name: 7-ethoxycarbonyl-1,3-benzodioxole-4-carboxylic acid. InChIKey: ULUKZMKEFUZNRM-UHFFFAOYSA-N.
| Molecular formula | C11H10O6 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 7-ethoxycarbonyl-1,3-benzodioxole-4-carboxylic acid |
| InChIKey | ULUKZMKEFUZNRM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2C(=C(C=C1)C(=O)O)OCO2 |
Computed by PubChem (NCBI)