CAS 35354-29-1 appears in our catalog under these names: 3,5-Diacetoxybenzoic acid, 95%, 3,5–Diacetoxybenzoic acid, 3,5-Diacetoxybenzoic Acid, 3,5-Diacetoxybenzoic acid 98%, 3,5-Diacetoxybenzoic acid, 96%, 96%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 1g, 5g, 10g, 50g, 100g, 100mg, 250mg.
3,5-diacetyloxybenzoic acid (CAS 35354-29-1) is a chemical compound with the molecular formula C11H10O6 and a molecular weight of 238.19 g/mol. IUPAC name: 3,5-diacetyloxybenzoic acid. InChIKey: QBTDQJMLMVEUTQ-UHFFFAOYSA-N.
| Molecular formula | C11H10O6 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 3,5-diacetyloxybenzoic acid |
| InChIKey | QBTDQJMLMVEUTQ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=CC(=C1)C(=O)O)OC(=O)C |
Computed by PubChem (NCBI)