Products 38588-64-6
CAS 38588-64-6 appears in our catalog under these names: 3,5-Bis(methoxycarbonyl)benzoic acid, 95%, 3,5-Bis(methoxycarbonyl)benzoic acid, 97%, 3，5–Bis(methoxycarbonyl)benzoic acid, 3,5-Bis(methoxycarbonyl)benzoic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 50mg.
3,5-bis(methoxycarbonyl)benzoic acid (CAS 38588-64-6) is a chemical compound with the molecular formula C11H10O6 and a molecular weight of 238.19 g/mol. IUPAC name: 3,5-bis(methoxycarbonyl)benzoic acid. InChIKey: OGZWRRQXMPHWIZ-UHFFFAOYSA-N.
| Molecular formula | C11H10O6 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 3,5-bis(methoxycarbonyl)benzoic acid |
| InChIKey | OGZWRRQXMPHWIZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C(=O)O)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
3,5-Bis(methoxycarbonyl)benzoic acid, 1,3,5-Benzenetricarboxylic acid, dimethyl ester, Dimethyl trimesicate; Trimesic acid dimethyl ester, 3,5-di(methoxycarbonyl)benzoic acid, 1,3,5-Benzenetricarboxylic acid, 1,3-dimethyl ester, OGZWRRQXMPHWIZ-UHFFFAOYSA-N, 3,5-bis(methoxycarbonyl)benzoicaci, 3,5-Bis(methoxycarbonyl)benzoicacid