Products 4475-29-0

CAS 4475-29-0 is the registry number for Ferulic acid Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(4-hydroxy-3-methoxyphenyl)methylidene]propanedioic acid (CAS 4475-29-0) is a chemical compound with the molecular formula C11H10O6 and a molecular weight of 238.19 g/mol. IUPAC name: 2-[(4-hydroxy-3-methoxyphenyl)methylidene]propanedioic acid. InChIKey: QQNCKWXXHNJAQX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10O6
Molecular weight238.19 g/mol
IUPAC name2-[(4-hydroxy-3-methoxyphenyl)methylidene]propanedioic acid
InChIKeyQQNCKWXXHNJAQX-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)C=C(C(=O)O)C(=O)O)O

Computed by PubChem (NCBI)