Products 1794753-19-7
CAS 1794753-19-7 is the registry number for Mono(2-carboxyethyl) Phthalate-d4. Offered by: TRC. Available pack sizes: 25mg.
2-(2-carboxyethoxycarbonyl)-3,4,5,6-tetradeuteriobenzoic acid (CAS 1794753-19-7) is a chemical compound with the molecular formula C11H10O6 and a molecular weight of 242.22 g/mol. IUPAC name: 2-(2-carboxyethoxycarbonyl)-3,4,5,6-tetradeuteriobenzoic acid. InChIKey: OSXPVFSMSBQPBU-RHQRLBAQSA-N.
| Molecular formula | C11H10O6 |
|---|---|
| Molecular weight | 242.22 g/mol |
| IUPAC name | 2-(2-carboxyethoxycarbonyl)-3,4,5,6-tetradeuteriobenzoic acid |
| InChIKey | OSXPVFSMSBQPBU-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCCC(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)