CAS 58534-64-8 appears in our catalog under these names: 3,4-Diacetoxy-benzoic acid, 95%, Protocatechuic Acid Diacetate, 3,4-Diacetoxybenzoic acid, 3,4-Diacetoxybenzoic acid 97%, 3,4-bis(acetyloxy)benzoic acid, 97%, 97%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 2g, 1g, 5g, 1000mg, 500mg, 2000mg, 10g.
3,4-diacetyloxybenzoic acid (CAS 58534-64-8) is a chemical compound with the molecular formula C11H10O6 and a molecular weight of 238.19 g/mol. IUPAC name: 3,4-diacetyloxybenzoic acid. InChIKey: FJVSTYFZOUSZCS-UHFFFAOYSA-N.
| Molecular formula | C11H10O6 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 3,4-diacetyloxybenzoic acid |
| InChIKey | FJVSTYFZOUSZCS-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)C(=O)O)OC(=O)C |
Computed by PubChem (NCBI)