CAS 92569-47-6 is the registry number for Mono(2-carboxyethyl) Phthalate. Offered by: TRC. Available pack sizes: 1g.
2-(2-carboxyethoxycarbonyl)benzoic acid (CAS 92569-47-6) is a chemical compound with the molecular formula C11H10O6 and a molecular weight of 238.19 g/mol. IUPAC name: 2-(2-carboxyethoxycarbonyl)benzoic acid. InChIKey: OSXPVFSMSBQPBU-UHFFFAOYSA-N.
| Molecular formula | C11H10O6 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 2-(2-carboxyethoxycarbonyl)benzoic acid |
| InChIKey | OSXPVFSMSBQPBU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)OCCC(=O)O |
Computed by PubChem (NCBI)