CAS 51-01-4 appears in our catalog under these names: 2,4-Bis(acetyloxy)benzoic acid, 95%, 2,4-Bis(acetyloxy)benzoic acid, 95-<97%, 2,4-Diacetoxybenzoic acid, 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 25g, 50g, 100g.
2,4-diacetyloxybenzoic acid (CAS 51-01-4) is a chemical compound with the molecular formula C11H10O6 and a molecular weight of 238.19 g/mol. IUPAC name: 2,4-diacetyloxybenzoic acid. InChIKey: GZVIEFAFWBQDLQ-UHFFFAOYSA-N.
| Molecular formula | C11H10O6 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 2,4-diacetyloxybenzoic acid |
| InChIKey | GZVIEFAFWBQDLQ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=C(C=C1)C(=O)O)OC(=O)C |
Computed by PubChem (NCBI)