CAS 164329-24-2 is the registry number for 2,4,6-Trihydroxybenzaldehyde 2,4-Diacetate. Offered by: TRC. Available pack sizes: 500mg, 5g.
(3-acetyloxy-4-formyl-5-hydroxyphenyl) acetate (CAS 164329-24-2) is a chemical compound with the molecular formula C11H10O6 and a molecular weight of 238.19 g/mol. IUPAC name: (3-acetyloxy-4-formyl-5-hydroxyphenyl) acetate. InChIKey: IULYROKRCRZRES-UHFFFAOYSA-N.
| Molecular formula | C11H10O6 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | (3-acetyloxy-4-formyl-5-hydroxyphenyl) acetate |
| InChIKey | IULYROKRCRZRES-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=C(C(=C1)OC(=O)C)C=O)O |
Computed by PubChem (NCBI)