Products 117883-46-2
CAS 117883-46-2 is the registry number for 5-Chloro-6-hydroxy-2,3-dihydro-1H-indole-2,3-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-chloro-6-hydroxy-1H-indole-2,3-dione (CAS 117883-46-2) is a chemical compound with the molecular formula C8H4ClNO3 and a molecular weight of 197.57 g/mol. IUPAC name: 5-chloro-6-hydroxy-1H-indole-2,3-dione. InChIKey: WUBUDHMLLNMEJS-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO3 |
|---|---|
| Molecular weight | 197.57 g/mol |
| IUPAC name | 5-chloro-6-hydroxy-1H-indole-2,3-dione |
| InChIKey | WUBUDHMLLNMEJS-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)O)NC(=O)C2=O |
Computed by PubChem (NCBI)