CAS 118431-03-1 is the registry number for Benidipine Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2E)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate (CAS 118431-03-1) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: methyl (2E)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate. InChIKey: LYUBYLJQOZIBQB-YRNVUSSQSA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | methyl (2E)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate |
| InChIKey | LYUBYLJQOZIBQB-YRNVUSSQSA-N |
| SMILES | CC(=O)/C(=C\C1=CC(=CC=C1)[N+](=O)[O-])/C(=O)OC |
Computed by PubChem (NCBI)