CAS 39562-17-9 appears in our catalog under these names: Methyl 2-(3-Nitrobenzylidene)-3-oxobutanoate (1:1 E/Z Mixture), Methyl 2-(3-nitrobenzylidene)-3-oxobutanoate, 97%, 97%. Offered by: TRC, Chemat. Available pack sizes: 500mg, 5g, 1g, 25g, 100g.
Methyl 2-[(3-nitrophenyl)methylidene]-3-oxobutanoate (CAS 39562-17-9) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: methyl 2-[(3-nitrophenyl)methylidene]-3-oxobutanoate. InChIKey: LYUBYLJQOZIBQB-UHFFFAOYSA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | methyl 2-[(3-nitrophenyl)methylidene]-3-oxobutanoate |
| InChIKey | LYUBYLJQOZIBQB-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=CC1=CC(=CC=C1)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)