CAS 119128-13-1 appears in our catalog under these names: Manidipine Benzylidene, Manidipine Impurity 3, (Z)-Methyl 2-(3-Nitrobenzylidene)-3-oxobutanoate, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 5g.
Methyl (2Z)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate (CAS 119128-13-1) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: methyl (2Z)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate. InChIKey: LYUBYLJQOZIBQB-XFFZJAGNSA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | methyl (2Z)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate |
| InChIKey | LYUBYLJQOZIBQB-XFFZJAGNSA-N |
| SMILES | CC(=O)/C(=C/C1=CC(=CC=C1)[N+](=O)[O-])/C(=O)OC |
Computed by PubChem (NCBI)