Products 1190312-84-5
CAS 1190312-84-5 is the registry number for 3-Nitro-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid, 95+%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
3-nitro-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid (CAS 1190312-84-5) is a chemical compound with the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. IUPAC name: 3-nitro-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid. InChIKey: HVLTYCFBJVUXIL-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O4 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 3-nitro-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid |
| InChIKey | HVLTYCFBJVUXIL-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1NC=C2[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)