Products 1201824-14-7
CAS 1201824-14-7 appears in our catalog under these names: N-Methyl-3-(trifluoromethoxy)aniline hydrochloride, N-Methyl-3-(trifluoromethoxy)aniline hydrochloride, 95%. Offered by: Biosynth, Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 2,5g, 100mg, 1g.
N-methyl-3-(trifluoromethoxy)aniline;hydrochloride (CAS 1201824-14-7) is a chemical compound with the molecular formula C8H9ClF3NO and a molecular weight of 227.61 g/mol. IUPAC name: N-methyl-3-(trifluoromethoxy)aniline;hydrochloride. InChIKey: TVMPKHPYBZPMJR-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3NO |
|---|---|
| Molecular weight | 227.61 g/mol |
| IUPAC name | N-methyl-3-(trifluoromethoxy)aniline;hydrochloride |
| InChIKey | TVMPKHPYBZPMJR-UHFFFAOYSA-N |
| SMILES | CNC1=CC(=CC=C1)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)