CAS 1216497-60-7 appears in our catalog under these names: 2-(2,4-Dichlorophenyl)propan-2-amine hydrochloride, 97%, 2-(2,4-Dichlorophenyl)propan-2-amine hydrochloride 95%, 2-(2,4-Dichlorophenyl)propan-2-amine hydrochloride, 95%, 95%, 2-(2,4-Dichlorophenyl)propan-2-amine hydrochloride, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-(2,4-dichlorophenyl)propan-2-amine;hydrochloride (CAS 1216497-60-7) is a chemical compound with the molecular formula C9H12Cl3N and a molecular weight of 240.6 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)propan-2-amine;hydrochloride. InChIKey: DONBZZYSLNXYQI-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl3N |
|---|---|
| Molecular weight | 240.6 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)propan-2-amine;hydrochloride |
| InChIKey | DONBZZYSLNXYQI-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C=C(C=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)