CAS 2138568-12-2 appears in our catalog under these names: 3.4-dichloro-n-propylaniline hydrochloride, 95%, 3,4-Dichloro-N-propylaniline hydrochloride, 98%, 3,4-Dichloro-N-propylaniline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3,4-dichloro-N-propylaniline;hydrochloride (CAS 2138568-12-2) is a chemical compound with the molecular formula C9H12Cl3N and a molecular weight of 240.6 g/mol. IUPAC name: 3,4-dichloro-N-propylaniline;hydrochloride. InChIKey: KRBODGOXRSIOIK-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl3N |
|---|---|
| Molecular weight | 240.6 g/mol |
| IUPAC name | 3,4-dichloro-N-propylaniline;hydrochloride |
| InChIKey | KRBODGOXRSIOIK-UHFFFAOYSA-N |
| SMILES | CCCNC1=CC(=C(C=C1)Cl)Cl.Cl |
Computed by PubChem (NCBI)