CAS 1423033-17-3 appears in our catalog under these names: 1–(2,6–dichlorophenyl)propan–2–amine hydrochloride, 1-(2,6-Dichlorophenyl)propan-2-amine hydrochloride. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 500mg, 50mg, 0,5g.
1-(2,6-dichlorophenyl)propan-2-amine;hydrochloride (CAS 1423033-17-3) is a chemical compound with the molecular formula C9H12Cl3N and a molecular weight of 240.6 g/mol. IUPAC name: 1-(2,6-dichlorophenyl)propan-2-amine;hydrochloride. InChIKey: GOFYHVBZDVPUKP-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl3N |
|---|---|
| Molecular weight | 240.6 g/mol |
| IUPAC name | 1-(2,6-dichlorophenyl)propan-2-amine;hydrochloride |
| InChIKey | GOFYHVBZDVPUKP-UHFFFAOYSA-N |
| SMILES | CC(CC1=C(C=CC=C1Cl)Cl)N.Cl |
Computed by PubChem (NCBI)