CAS 1417638-35-7 appears in our catalog under these names: 2–(3,5–dichlorophenyl)propan–2–amine hydrochloride, 2-(3,5-Dichlorophenyl)propan-2-amine hydrochloride, 2-(3,5-dichlorophenyl)propan-2-amine hydrochloride. Offered by: GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1g, 250mg, 2,5g.
2-(3,5-dichlorophenyl)propan-2-amine;hydrochloride (CAS 1417638-35-7) is a chemical compound with the molecular formula C9H12Cl3N and a molecular weight of 240.6 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)propan-2-amine;hydrochloride. InChIKey: ZNPYGKNJDQJNPA-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl3N |
|---|---|
| Molecular weight | 240.6 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)propan-2-amine;hydrochloride |
| InChIKey | ZNPYGKNJDQJNPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC(=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)