CAS 847448-33-3 is the registry number for 1-(3,4-Dichlorophenyl)propan-1-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(3,4-dichlorophenyl)propan-1-amine;hydrochloride (CAS 847448-33-3) is a chemical compound with the molecular formula C9H12Cl3N and a molecular weight of 240.6 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)propan-1-amine;hydrochloride. InChIKey: FEEGTQCAUBOZDI-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl3N |
|---|---|
| Molecular weight | 240.6 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)propan-1-amine;hydrochloride |
| InChIKey | FEEGTQCAUBOZDI-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC(=C(C=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)