CAS 90389-20-1 appears in our catalog under these names: [(3,4-Dichlorophenyl)methyl](ethyl)amine hydrochloride, 95%, ((3,4-Dichlorophenyl)methyl)(ethyl)amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g, 250mg.
N-[(3,4-dichlorophenyl)methyl]ethanamine;hydrochloride (CAS 90389-20-1) is a chemical compound with the molecular formula C9H12Cl3N and a molecular weight of 240.6 g/mol. IUPAC name: N-[(3,4-dichlorophenyl)methyl]ethanamine;hydrochloride. InChIKey: HASMVVHCPCKYTJ-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl3N |
|---|---|
| Molecular weight | 240.6 g/mol |
| IUPAC name | N-[(3,4-dichlorophenyl)methyl]ethanamine;hydrochloride |
| InChIKey | HASMVVHCPCKYTJ-UHFFFAOYSA-N |
| SMILES | CCNCC1=CC(=C(C=C1)Cl)Cl.Cl |
Computed by PubChem (NCBI)