CAS 1391503-15-3 appears in our catalog under these names: (1R)-1-(2,6-Dichlorophenyl)propan-1-amine hydrochloride, 95%, (R)–1–(2,6–dichlorophenyl)propan–1–amine hcl, (R)-1-(2,6-dichlorophenyl)propan-1-amine hcl, 95%, 95%, (R)-1-(2,6-dichlorophenyl)propan-1-amine hcl, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(1R)-1-(2,6-dichlorophenyl)propan-1-amine;hydrochloride (CAS 1391503-15-3) is a chemical compound with the molecular formula C9H12Cl3N and a molecular weight of 240.6 g/mol. IUPAC name: (1R)-1-(2,6-dichlorophenyl)propan-1-amine;hydrochloride. InChIKey: RYFPZKXDFHRLEQ-DDWIOCJRSA-N.
| Molecular formula | C9H12Cl3N |
|---|---|
| Molecular weight | 240.6 g/mol |
| IUPAC name | (1R)-1-(2,6-dichlorophenyl)propan-1-amine;hydrochloride |
| InChIKey | RYFPZKXDFHRLEQ-DDWIOCJRSA-N |
| SMILES | CC[C@H](C1=C(C=CC=C1Cl)Cl)N.Cl |
Computed by PubChem (NCBI)