CAS 1803601-63-9 is the registry number for 2,3-Dichloro-N-propylaniline hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2,3-dichloro-N-propylaniline;hydrochloride (CAS 1803601-63-9) is a chemical compound with the molecular formula C9H12Cl3N and a molecular weight of 240.6 g/mol. IUPAC name: 2,3-dichloro-N-propylaniline;hydrochloride. InChIKey: VBVOHWOZHHUGMM-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl3N |
|---|---|
| Molecular weight | 240.6 g/mol |
| IUPAC name | 2,3-dichloro-N-propylaniline;hydrochloride |
| InChIKey | VBVOHWOZHHUGMM-UHFFFAOYSA-N |
| SMILES | CCCNC1=C(C(=CC=C1)Cl)Cl.Cl |
Computed by PubChem (NCBI)