CAS 2719778-44-4 is the registry number for 2-(2,3-Dichlorophenyl)propan-2-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,3-dichlorophenyl)propan-2-amine;hydrochloride (CAS 2719778-44-4) is a chemical compound with the molecular formula C9H12Cl3N and a molecular weight of 240.6 g/mol. IUPAC name: 2-(2,3-dichlorophenyl)propan-2-amine;hydrochloride. InChIKey: ILCOYVNVSHSUMN-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl3N |
|---|---|
| Molecular weight | 240.6 g/mol |
| IUPAC name | 2-(2,3-dichlorophenyl)propan-2-amine;hydrochloride |
| InChIKey | ILCOYVNVSHSUMN-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C(=CC=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)