CAS 742107-61-5 is the registry number for (R)-1-(3,4-Dichlorophenyl)propan-1-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(3,4-dichlorophenyl)propan-1-amine;hydrochloride (CAS 742107-61-5) is a chemical compound with the molecular formula C9H12Cl3N and a molecular weight of 240.6 g/mol. IUPAC name: (1R)-1-(3,4-dichlorophenyl)propan-1-amine;hydrochloride. InChIKey: FEEGTQCAUBOZDI-SBSPUUFOSA-N.
| Molecular formula | C9H12Cl3N |
|---|---|
| Molecular weight | 240.6 g/mol |
| IUPAC name | (1R)-1-(3,4-dichlorophenyl)propan-1-amine;hydrochloride |
| InChIKey | FEEGTQCAUBOZDI-SBSPUUFOSA-N |
| SMILES | CC[C@H](C1=CC(=C(C=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)