CAS 1227270-64-5 is the registry number for 5-Chloro-2,3-difluorobenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-chloro-2,3-difluorobenzoic acid (CAS 1227270-64-5) is a chemical compound with the molecular formula C7H3ClF2O2 and a molecular weight of 192.55 g/mol. IUPAC name: 5-chloro-2,3-difluorobenzoic acid. InChIKey: YJEQGFPRIWHFFM-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O2 |
|---|---|
| Molecular weight | 192.55 g/mol |
| IUPAC name | 5-chloro-2,3-difluorobenzoic acid |
| InChIKey | YJEQGFPRIWHFFM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)F)F)Cl |
Computed by PubChem (NCBI)