Products 1227270-64-5

CAS 1227270-64-5 is the registry number for 5-Chloro-2,3-difluorobenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-chloro-2,3-difluorobenzoic acid (CAS 1227270-64-5) is a chemical compound with the molecular formula C7H3ClF2O2 and a molecular weight of 192.55 g/mol. IUPAC name: 5-chloro-2,3-difluorobenzoic acid. InChIKey: YJEQGFPRIWHFFM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3ClF2O2
Molecular weight192.55 g/mol
IUPAC name5-chloro-2,3-difluorobenzoic acid
InChIKeyYJEQGFPRIWHFFM-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)F)F)Cl

Computed by PubChem (NCBI)