Products 1235440-67-1
CAS 1235440-67-1 is the registry number for 2-(3-Chlorofuran-2-yl)-4,5-dimethyl-1,3-oxazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3-chlorofuran-2-yl)-4,5-dimethyl-1,3-oxazole (CAS 1235440-67-1) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: 2-(3-chlorofuran-2-yl)-4,5-dimethyl-1,3-oxazole. InChIKey: RWLFHAWCZBSVBC-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 2-(3-chlorofuran-2-yl)-4,5-dimethyl-1,3-oxazole |
| InChIKey | RWLFHAWCZBSVBC-UHFFFAOYSA-N |
| SMILES | CC1=C(OC(=N1)C2=C(C=CO2)Cl)C |
Computed by PubChem (NCBI)