Products 1236303-03-9
CAS 1236303-03-9 is the registry number for Methyl 2-cyclopropyl-4-(trifluoromethyl)benzoate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl 2-cyclopropyl-4-(trifluoromethyl)benzoate (CAS 1236303-03-9) is a chemical compound with the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. IUPAC name: methyl 2-cyclopropyl-4-(trifluoromethyl)benzoate. InChIKey: IHUSXRIITFJZSF-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O2 |
|---|---|
| Molecular weight | 244.21 g/mol |
| IUPAC name | methyl 2-cyclopropyl-4-(trifluoromethyl)benzoate |
| InChIKey | IHUSXRIITFJZSF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C(F)(F)F)C2CC2 |
Computed by PubChem (NCBI)