CAS 1248215-19-1 appears in our catalog under these names: 3-(2,5-Dichlorobenzoyl)oxolane, 98%, 3-(2,5-Dichlorobenzoyl)oxolane. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(2,5-dichlorophenyl)-(oxolan-3-yl)methanone (CAS 1248215-19-1) is a chemical compound with the molecular formula C11H10Cl2O2 and a molecular weight of 245.10 g/mol. IUPAC name: (2,5-dichlorophenyl)-(oxolan-3-yl)methanone. InChIKey: NJJXKHBAAOHDPI-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2O2 |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | (2,5-dichlorophenyl)-(oxolan-3-yl)methanone |
| InChIKey | NJJXKHBAAOHDPI-UHFFFAOYSA-N |
| SMILES | C1COCC1C(=O)C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)