CAS 22073-09-2 is the registry number for 5,5–dichloro–2–phenylpent–4–enoic acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
5,5-dichloro-2-phenylpent-4-enoic acid (CAS 22073-09-2) is a chemical compound with the molecular formula C11H10Cl2O2 and a molecular weight of 245.10 g/mol. IUPAC name: 5,5-dichloro-2-phenylpent-4-enoic acid. InChIKey: DVTZYKAMFYBUKV-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2O2 |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 5,5-dichloro-2-phenylpent-4-enoic acid |
| InChIKey | DVTZYKAMFYBUKV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC=C(Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)