Products 1517645-08-7
CAS 1517645-08-7 is the registry number for 2-(3,4-Dichlorophenyl)cyclobutanecarboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(3,4-dichlorophenyl)cyclobutane-1-carboxylic acid (CAS 1517645-08-7) is a chemical compound with the molecular formula C11H10Cl2O2 and a molecular weight of 245.10 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)cyclobutane-1-carboxylic acid. InChIKey: YYEDFIAXNJMHCD-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2O2 |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)cyclobutane-1-carboxylic acid |
| InChIKey | YYEDFIAXNJMHCD-UHFFFAOYSA-N |
| SMILES | C1CC(C1C2=CC(=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)