CAS 151157-50-5 is the registry number for 1-(2,4-Dichlorophenyl)cyclobutanecarboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(2,4-dichlorophenyl)cyclobutane-1-carboxylic acid (CAS 151157-50-5) is a chemical compound with the molecular formula C11H10Cl2O2 and a molecular weight of 245.10 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)cyclobutane-1-carboxylic acid. InChIKey: WTPHLOSEZLUICF-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2O2 |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)cyclobutane-1-carboxylic acid |
| InChIKey | WTPHLOSEZLUICF-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=C(C=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)