CAS 1251301-46-8 appears in our catalog under these names: 1,3-Dimethyl-5-(3-methyl-1H-pyrazol-1-yl)-1H-pyrazole-4-carboxylic acid, 95%, 1,3-Dimethyl-5-(3-methyl-1H-pyrazol-1-yl)-1H-pyrazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1,3-dimethyl-5-(3-methylpyrazol-1-yl)pyrazole-4-carboxylic acid (CAS 1251301-46-8) is a chemical compound with the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. IUPAC name: 1,3-dimethyl-5-(3-methylpyrazol-1-yl)pyrazole-4-carboxylic acid. InChIKey: KEYKCKOTIORUGP-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2 |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | 1,3-dimethyl-5-(3-methylpyrazol-1-yl)pyrazole-4-carboxylic acid |
| InChIKey | KEYKCKOTIORUGP-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1)C2=C(C(=NN2C)C)C(=O)O |
Computed by PubChem (NCBI)