CAS 1259992-43-2 is the registry number for 3,5-Dibromo-DL-phenylalanine, 97%. Offered by: AmBeed. Available pack sizes: 100mg, 1g.
2-amino-3-(3,5-dibromophenyl)propanoic acid (CAS 1259992-43-2) is a chemical compound with the molecular formula C9H9Br2NO2 and a molecular weight of 322.98 g/mol. IUPAC name: 2-amino-3-(3,5-dibromophenyl)propanoic acid. InChIKey: JDHBRWDIELMBHR-UHFFFAOYSA-N.
| Molecular formula | C9H9Br2NO2 |
|---|---|
| Molecular weight | 322.98 g/mol |
| IUPAC name | 2-amino-3-(3,5-dibromophenyl)propanoic acid |
| InChIKey | JDHBRWDIELMBHR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)CC(C(=O)O)N |
Computed by PubChem (NCBI)