Products 1239843-56-1
CAS 1239843-56-1 is the registry number for 3-(3-Aminophenyl)-2,3-dibromopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-aminophenyl)-2,3-dibromopropanoic acid (CAS 1239843-56-1) is a chemical compound with the molecular formula C9H9Br2NO2 and a molecular weight of 322.98 g/mol. IUPAC name: 3-(3-aminophenyl)-2,3-dibromopropanoic acid. InChIKey: YWKGMSUIJCYVNW-UHFFFAOYSA-N.
| Molecular formula | C9H9Br2NO2 |
|---|---|
| Molecular weight | 322.98 g/mol |
| IUPAC name | 3-(3-aminophenyl)-2,3-dibromopropanoic acid |
| InChIKey | YWKGMSUIJCYVNW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C(C(C(=O)O)Br)Br |
Computed by PubChem (NCBI)