Products 353754-49-1
CAS 353754-49-1 appears in our catalog under these names: Ethyl 2-amino-3,5-dibromobenzoate, 95%, Ethyl 2-amino-3,5-dibromobenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
Ethyl 2-amino-3,5-dibromobenzoate (CAS 353754-49-1) is a chemical compound with the molecular formula C9H9Br2NO2 and a molecular weight of 322.98 g/mol. IUPAC name: ethyl 2-amino-3,5-dibromobenzoate. InChIKey: NERSGAMVWBINET-UHFFFAOYSA-N.
| Molecular formula | C9H9Br2NO2 |
|---|---|
| Molecular weight | 322.98 g/mol |
| IUPAC name | ethyl 2-amino-3,5-dibromobenzoate |
| InChIKey | NERSGAMVWBINET-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC(=C1)Br)Br)N |
Computed by PubChem (NCBI)