CAS 1703987-44-3 is the registry number for Methyl (S)-2-amino-2-(3,5-dibromophenyl)acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-amino-2-(3,5-dibromophenyl)acetate (CAS 1703987-44-3) is a chemical compound with the molecular formula C9H9Br2NO2 and a molecular weight of 322.98 g/mol. IUPAC name: methyl (2S)-2-amino-2-(3,5-dibromophenyl)acetate. InChIKey: PPXIXLPBAMEEAD-QMMMGPOBSA-N.
| Molecular formula | C9H9Br2NO2 |
|---|---|
| Molecular weight | 322.98 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-(3,5-dibromophenyl)acetate |
| InChIKey | PPXIXLPBAMEEAD-QMMMGPOBSA-N |
| SMILES | COC(=O)[C@H](C1=CC(=CC(=C1)Br)Br)N |
Computed by PubChem (NCBI)