CAS 443664-21-9 is the registry number for 2-(2,4-Dibromo-6-methylphenoxy)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4-dibromo-6-methylphenoxy)acetamide (CAS 443664-21-9) is a chemical compound with the molecular formula C9H9Br2NO2 and a molecular weight of 322.98 g/mol. IUPAC name: 2-(2,4-dibromo-6-methylphenoxy)acetamide. InChIKey: VPVWIPCHRPGPFN-UHFFFAOYSA-N.
| Molecular formula | C9H9Br2NO2 |
|---|---|
| Molecular weight | 322.98 g/mol |
| IUPAC name | 2-(2,4-dibromo-6-methylphenoxy)acetamide |
| InChIKey | VPVWIPCHRPGPFN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OCC(=O)N)Br)Br |
Computed by PubChem (NCBI)