CAS 2121512-81-8 appears in our catalog under these names: Propan-2-yl 3,5-dibromopyridine-4-carboxylate, 95%, Isopropyl 3,5-dibromoisonicotinate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Propan-2-yl 3,5-dibromopyridine-4-carboxylate (CAS 2121512-81-8) is a chemical compound with the molecular formula C9H9Br2NO2 and a molecular weight of 322.98 g/mol. IUPAC name: propan-2-yl 3,5-dibromopyridine-4-carboxylate. InChIKey: CXCVNGMQKWXZOL-UHFFFAOYSA-N.
| Molecular formula | C9H9Br2NO2 |
|---|---|
| Molecular weight | 322.98 g/mol |
| IUPAC name | propan-2-yl 3,5-dibromopyridine-4-carboxylate |
| InChIKey | CXCVNGMQKWXZOL-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=C(C=NC=C1Br)Br |
Computed by PubChem (NCBI)