Products 1352397-65-9
CAS 1352397-65-9 is the registry number for 3-Amino-2,6-dibromo-4-methylbenzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 3-amino-2,6-dibromo-4-methylbenzoate (CAS 1352397-65-9) is a chemical compound with the molecular formula C9H9Br2NO2 and a molecular weight of 322.98 g/mol. IUPAC name: methyl 3-amino-2,6-dibromo-4-methylbenzoate. InChIKey: YGAOHYSTOURSEQ-UHFFFAOYSA-N.
| Molecular formula | C9H9Br2NO2 |
|---|---|
| Molecular weight | 322.98 g/mol |
| IUPAC name | methyl 3-amino-2,6-dibromo-4-methylbenzoate |
| InChIKey | YGAOHYSTOURSEQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1N)Br)C(=O)OC)Br |
Computed by PubChem (NCBI)