Products 1430058-73-3
CAS 1430058-73-3 is the registry number for Ethyl 6-bromo-2-(bromomethyl)nicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 6-bromo-2-(bromomethyl)pyridine-3-carboxylate (CAS 1430058-73-3) is a chemical compound with the molecular formula C9H9Br2NO2 and a molecular weight of 322.98 g/mol. IUPAC name: ethyl 6-bromo-2-(bromomethyl)pyridine-3-carboxylate. InChIKey: XOUOKBWGVRANFV-UHFFFAOYSA-N.
| Molecular formula | C9H9Br2NO2 |
|---|---|
| Molecular weight | 322.98 g/mol |
| IUPAC name | ethyl 6-bromo-2-(bromomethyl)pyridine-3-carboxylate |
| InChIKey | XOUOKBWGVRANFV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(C=C1)Br)CBr |
Computed by PubChem (NCBI)