CAS 1270112-78-1 is the registry number for (S)-3-amino-3-(3,5-dibromophenyl)propanoic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-3-amino-3-(3,5-dibromophenyl)propanoic acid (CAS 1270112-78-1) is a chemical compound with the molecular formula C9H9Br2NO2 and a molecular weight of 322.98 g/mol. IUPAC name: (3S)-3-amino-3-(3,5-dibromophenyl)propanoic acid. InChIKey: BGOZWRSTHRDJSS-QMMMGPOBSA-N.
| Molecular formula | C9H9Br2NO2 |
|---|---|
| Molecular weight | 322.98 g/mol |
| IUPAC name | (3S)-3-amino-3-(3,5-dibromophenyl)propanoic acid |
| InChIKey | BGOZWRSTHRDJSS-QMMMGPOBSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)