Products 381224-18-6
CAS 381224-18-6 appears in our catalog under these names: Methyl 2,6-bis(bromomethyl)isonicotinate, 98%, Methyl 2,6-bis(bromomethyl)isonicotinate. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 2g, 1g, 5g, 25g, 10g.
Methyl 2,6-bis(bromomethyl)pyridine-4-carboxylate (CAS 381224-18-6) is a chemical compound with the molecular formula C9H9Br2NO2 and a molecular weight of 322.98 g/mol. IUPAC name: methyl 2,6-bis(bromomethyl)pyridine-4-carboxylate. InChIKey: WRCNHVLCKGQMSI-UHFFFAOYSA-N.
| Molecular formula | C9H9Br2NO2 |
|---|---|
| Molecular weight | 322.98 g/mol |
| IUPAC name | methyl 2,6-bis(bromomethyl)pyridine-4-carboxylate |
| InChIKey | WRCNHVLCKGQMSI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC(=C1)CBr)CBr |
Computed by PubChem (NCBI)