Products 1260674-54-1
CAS 1260674-54-1 is the registry number for 4-Chloro-7-methoxyindolin-2-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-chloro-7-methoxy-1,3-dihydroindol-2-one (CAS 1260674-54-1) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: 4-chloro-7-methoxy-1,3-dihydroindol-2-one. InChIKey: CWZZAEACOXJXFW-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 4-chloro-7-methoxy-1,3-dihydroindol-2-one |
| InChIKey | CWZZAEACOXJXFW-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)Cl)CC(=O)N2 |
Computed by PubChem (NCBI)