Products 1274920-94-3
CAS 1274920-94-3 is the registry number for 1-((4-Chlorophenyl)methyl)-3,5-dimethyl-1H-pyrazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-[(4-chlorophenyl)methyl]-3,5-dimethylpyrazole (CAS 1274920-94-3) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: 1-[(4-chlorophenyl)methyl]-3,5-dimethylpyrazole. InChIKey: ZSEBRJMRDJSUHU-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | 1-[(4-chlorophenyl)methyl]-3,5-dimethylpyrazole |
| InChIKey | ZSEBRJMRDJSUHU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1CC2=CC=C(C=C2)Cl)C |
Computed by PubChem (NCBI)