Products 134099-42-6
CAS 134099-42-6 is the registry number for 2,3-Dichloro-4-(trifluoromethyl)benzaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,3-dichloro-4-(trifluoromethyl)benzaldehyde (CAS 134099-42-6) is a chemical compound with the molecular formula C8H3Cl2F3O and a molecular weight of 243.01 g/mol. IUPAC name: 2,3-dichloro-4-(trifluoromethyl)benzaldehyde. InChIKey: ZHKISGVSWWUHST-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O |
|---|---|
| Molecular weight | 243.01 g/mol |
| IUPAC name | 2,3-dichloro-4-(trifluoromethyl)benzaldehyde |
| InChIKey | ZHKISGVSWWUHST-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C=O)Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)