Products 1345955-98-7
CAS 1345955-98-7 appears in our catalog under these names: 2,7-Dichloropyrido[3,2-D]Pyrimidine, 98%, 2,7-Dichloropyrido[3,2-d]pyrimidine, 95+%. Offered by: Chemat, Fluorochem, Ambeed, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2,7-dichloropyrido[3,2-d]pyrimidine (CAS 1345955-98-7) is a chemical compound with the molecular formula C7H3Cl2N3 and a molecular weight of 200.02 g/mol. IUPAC name: 2,7-dichloropyrido[3,2-d]pyrimidine. InChIKey: BEBLWEIRQBXYAB-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3 |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 2,7-dichloropyrido[3,2-d]pyrimidine |
| InChIKey | BEBLWEIRQBXYAB-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=CN=C(N=C21)Cl)Cl |
Computed by PubChem (NCBI)