CAS 1354951-46-4 appears in our catalog under these names: 2–(Difluoromethoxy)–6–fluorobenzylamine hydrochloride, (2-(difluoromethoxy)-6-fluorophenyl)methanamine hydrochloride, 2-(Difluoromethoxy)-6-fluorobenzylamine hydrochloride, 95%, 95%, 2-(Difluoromethoxy)-6-fluorobenzylamine hydrochloride, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 25g.
[2-(difluoromethoxy)-6-fluorophenyl]methanamine;hydrochloride (CAS 1354951-46-4) is a chemical compound with the molecular formula C8H9ClF3NO and a molecular weight of 227.61 g/mol. IUPAC name: [2-(difluoromethoxy)-6-fluorophenyl]methanamine;hydrochloride. InChIKey: DWSHGBUTBUFECI-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3NO |
|---|---|
| Molecular weight | 227.61 g/mol |
| IUPAC name | [2-(difluoromethoxy)-6-fluorophenyl]methanamine;hydrochloride |
| InChIKey | DWSHGBUTBUFECI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CN)OC(F)F.Cl |
Computed by PubChem (NCBI)