CAS 1368597-34-5 is the registry number for 7-CHLORO-4-METHOXYINDOLIN-2-ONE 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
7-chloro-4-methoxy-1,3-dihydroindol-2-one (CAS 1368597-34-5) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: 7-chloro-4-methoxy-1,3-dihydroindol-2-one. InChIKey: HJDOLGDOXJAESD-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 7-chloro-4-methoxy-1,3-dihydroindol-2-one |
| InChIKey | HJDOLGDOXJAESD-UHFFFAOYSA-N |
| SMILES | COC1=C2CC(=O)NC2=C(C=C1)Cl |
Computed by PubChem (NCBI)